C16H22N2O — CID 108915633
1-[(E)-2-cyclopropylprop-1-enyl]-3-[2-(3-methylphenyl)ethyl]urea (PubChem CID 108915633) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 1-[(E)-2-cyclopropylprop-1-enyl]-3-[2-(3-methylphenyl)ethyl]urea.
| Compound Name | 1-[(E)-2-cyclopropylprop-1-enyl]-3-[2-(3-methylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 108915633 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 1-[(E)-2-cyclopropylprop-1-enyl]-3-[2-(3-methylphenyl)ethyl]urea |
| SMILES | C/C(=C\NC(=O)NCCc1cccc(C)c1)C1CC1 |
| InChI | InChI=1S/C16H22N2O/c1-12-4-3-5-14(10-12)8-9-17-16(19)18-11-13(2)15-6-7-15/h3-5,10-11,15H,6-9H2,1-2H3,(H2,17,18,19)/b13-11+ |
| InChIKey | SDCYLLHPWXDSSL-ACCUITESSA-N |
| XLogP | 3.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |