C16H34N2 — CID 21348322
3,5-diethyl-2,2,3,4,5-pentamethyl-1-propylpiperazine (PubChem CID 21348322) has the molecular formula C16H34N2 and a molecular weight of 254.46 g/mol. Its IUPAC name is 3,5-diethyl-2,2,3,4,5-pentamethyl-1-propylpiperazine.
| Compound Name | 3,5-diethyl-2,2,3,4,5-pentamethyl-1-propylpiperazine |
|---|---|
| PubChem CID | 21348322 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | 3,5-diethyl-2,2,3,4,5-pentamethyl-1-propylpiperazine |
| SMILES | CCCN1CC(C)(CC)N(C)C(C)(CC)C1(C)C |
| InChI | InChI=1S/C16H34N2/c1-9-12-18-13-15(6,10-2)17(8)16(7,11-3)14(18,4)5/h9-13H2,1-8H3 |
| InChIKey | HIQNZSAPYDKSBX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |