C18H25N5O2 — CID 21348582
ethyl 2-[3-[(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]pentyl]benzoate (PubChem CID 21348582) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is ethyl 2-[3-[(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]pentyl]benzoate.
| Compound Name | ethyl 2-[3-[(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]pentyl]benzoate |
|---|---|
| PubChem CID | 21348582 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | ethyl 2-[3-[(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]pentyl]benzoate |
| SMILES | CCOC(=O)c1ccccc1CCC(CC)Nc1nc(C)nc(N)n1 |
| InChI | InChI=1S/C18H25N5O2/c1-4-14(22-18-21-12(3)20-17(19)23-18)11-10-13-8-6-7-9-15(13)16(24)25-5-2/h6-9,14H,4-5,10-11H2,1-3H3,(H3,19,20,21,22,23) |
| InChIKey | PDRCLARPUWNALR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |