C26H26FN3O3S — CID 2134878
3-(4-fluorophenyl)-N,N,5-trimethyl-2,4-dioxo-1-[(2,4,6-trimethylphenyl)methyl]thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 2134878) has the molecular formula C26H26FN3O3S and a molecular weight of 479.58 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N,N,5-trimethyl-2,4-dioxo-1-[(2,4,6-trimethylphenyl)methyl]thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-N,N,5-trimethyl-2,4-dioxo-1-[(2,4,6-trimethylphenyl)methyl]thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 2134878 |
| Molecular Formula | C26H26FN3O3S |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 3-(4-fluorophenyl)-N,N,5-trimethyl-2,4-dioxo-1-[(2,4,6-trimethylphenyl)methyl]thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1cc(C)c(Cn2c(=O)n(-c3ccc(F)cc3)c(=O)c3c(C)c(C(=O)N(C)C)sc32)c(C)c1 |
| InChI | InChI=1S/C26H26FN3O3S/c1-14-11-15(2)20(16(3)12-14)13-29-25-21(17(4)22(34-25)24(32)28(5)6)23(31)30(26(29)33)19-9-7-18(27)8-10-19/h7-12H,13H2,1-6H3 |
| InChIKey | LUAVLHHRWLSHHG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 64.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |