C24H22N4O5S — CID 5075011
N,N,5-trimethyl-1-[(4-methylphenyl)methyl]-3-(2-nitrophenyl)-2,4-dioxothieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 5075011) has the molecular formula C24H22N4O5S and a molecular weight of 478.53 g/mol. Its IUPAC name is N,N,5-trimethyl-1-[(4-methylphenyl)methyl]-3-(2-nitrophenyl)-2,4-dioxothieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N,N,5-trimethyl-1-[(4-methylphenyl)methyl]-3-(2-nitrophenyl)-2,4-dioxothieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 5075011 |
| Molecular Formula | C24H22N4O5S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | N,N,5-trimethyl-1-[(4-methylphenyl)methyl]-3-(2-nitrophenyl)-2,4-dioxothieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1ccc(Cn2c(=O)n(-c3ccccc3[N+](=O)[O-])c(=O)c3c(C)c(C(=O)N(C)C)sc32)cc1 |
| InChI | InChI=1S/C24H22N4O5S/c1-14-9-11-16(12-10-14)13-26-23-19(15(2)20(34-23)22(30)25(3)4)21(29)27(24(26)31)17-7-5-6-8-18(17)28(32)33/h5-12H,13H2,1-4H3 |
| InChIKey | SXDYCLAYRIWKRF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 107.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|