C23H19N5O7S — CID 3323784
N,N,5-trimethyl-3-(2-nitrophenyl)-1-[(4-nitrophenyl)methyl]-2,4-dioxothieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 3323784) has the molecular formula C23H19N5O7S and a molecular weight of 509.50 g/mol. Its IUPAC name is N,N,5-trimethyl-3-(2-nitrophenyl)-1-[(4-nitrophenyl)methyl]-2,4-dioxothieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N,N,5-trimethyl-3-(2-nitrophenyl)-1-[(4-nitrophenyl)methyl]-2,4-dioxothieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 3323784 |
| Molecular Formula | C23H19N5O7S |
| Molecular Weight | 509.50 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | N,N,5-trimethyl-3-(2-nitrophenyl)-1-[(4-nitrophenyl)methyl]-2,4-dioxothieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)N(C)C)sc2c1c(=O)n(-c1ccccc1[N+](=O)[O-])c(=O)n2Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H19N5O7S/c1-13-18-20(29)26(16-6-4-5-7-17(16)28(34)35)23(31)25(22(18)36-19(13)21(30)24(2)3)12-14-8-10-15(11-9-14)27(32)33/h4-11H,12H2,1-3H3 |
| InChIKey | VPOHFEQFMUAHJQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 150.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|