C27H44O9 — CID 21349203
5-[2-[2,3-bis[2-(4-methyl-3-oxopent-4-enoxy)ethoxy]propoxy]ethoxy]-2-methylpent-1-en-3-one (PubChem CID 21349203) has the molecular formula C27H44O9 and a molecular weight of 512.64 g/mol. Its IUPAC name is 5-[2-[2,3-bis[2-(4-methyl-3-oxopent-4-enoxy)ethoxy]propoxy]ethoxy]-2-methylpent-1-en-3-one.
| Compound Name | 5-[2-[2,3-bis[2-(4-methyl-3-oxopent-4-enoxy)ethoxy]propoxy]ethoxy]-2-methylpent-1-en-3-one |
|---|---|
| PubChem CID | 21349203 |
| Molecular Formula | C27H44O9 |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | 5-[2-[2,3-bis[2-(4-methyl-3-oxopent-4-enoxy)ethoxy]propoxy]ethoxy]-2-methylpent-1-en-3-one |
| SMILES | C=C(C)C(=O)CCOCCOCC(COCCOCCC(=O)C(=C)C)OCCOCCC(=O)C(=C)C |
| InChI | InChI=1S/C27H44O9/c1-21(2)25(28)7-10-31-13-15-34-19-24(36-18-17-33-12-9-27(30)23(5)6)20-35-16-14-32-11-8-26(29)22(3)4/h24H,1,3,5,7-20H2,2,4,6H3 |
| InChIKey | JPFQYFLLYUPHER-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|