C21H32O6 — CID 59972182
5-[2,3-bis(4-methyl-3-oxopent-4-enoxy)propoxy]-2-methylpent-1-en-3-one (PubChem CID 59972182) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is 5-[2,3-bis(4-methyl-3-oxopent-4-enoxy)propoxy]-2-methylpent-1-en-3-one.
| Compound Name | 5-[2,3-bis(4-methyl-3-oxopent-4-enoxy)propoxy]-2-methylpent-1-en-3-one |
|---|---|
| PubChem CID | 59972182 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 5-[2,3-bis(4-methyl-3-oxopent-4-enoxy)propoxy]-2-methylpent-1-en-3-one |
| SMILES | C=C(C)C(=O)CCOCC(COCCC(=O)C(=C)C)OCCC(=O)C(=C)C |
| InChI | InChI=1S/C21H32O6/c1-15(2)19(22)7-10-25-13-18(27-12-9-21(24)17(5)6)14-26-11-8-20(23)16(3)4/h18H,1,3,5,7-14H2,2,4,6H3 |
| InChIKey | SWWRWUKRDPRUQJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|