C14H18N6O3 — CID 21349322
6-methyl-2-N-[1-[(3-nitrophenyl)methoxy]propan-2-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 21349322) has the molecular formula C14H18N6O3 and a molecular weight of 318.34 g/mol. Its IUPAC name is 6-methyl-2-N-[1-[(3-nitrophenyl)methoxy]propan-2-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-methyl-2-N-[1-[(3-nitrophenyl)methoxy]propan-2-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 21349322 |
| Molecular Formula | C14H18N6O3 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 6-methyl-2-N-[1-[(3-nitrophenyl)methoxy]propan-2-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1nc(N)nc(NC(C)COCc2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C14H18N6O3/c1-9(16-14-18-10(2)17-13(15)19-14)7-23-8-11-4-3-5-12(6-11)20(21)22/h3-6,9H,7-8H2,1-2H3,(H3,15,16,17,18,19) |
| InChIKey | QJYBEBAYXMAXSE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 129.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|