C18H23N5O3 — CID 21349381
N-[4-[1-[(4-formylphenyl)methoxy]butan-2-ylamino]-6-methyl-1,3,5-triazin-2-yl]acetamide (PubChem CID 21349381) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[4-[1-[(4-formylphenyl)methoxy]butan-2-ylamino]-6-methyl-1,3,5-triazin-2-yl]acetamide.
| Compound Name | N-[4-[1-[(4-formylphenyl)methoxy]butan-2-ylamino]-6-methyl-1,3,5-triazin-2-yl]acetamide |
|---|---|
| PubChem CID | 21349381 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-[4-[1-[(4-formylphenyl)methoxy]butan-2-ylamino]-6-methyl-1,3,5-triazin-2-yl]acetamide |
| SMILES | CCC(COCc1ccc(C=O)cc1)Nc1nc(C)nc(NC(C)=O)n1 |
| InChI | InChI=1S/C18H23N5O3/c1-4-16(11-26-10-15-7-5-14(9-24)6-8-15)22-18-20-12(2)19-17(23-18)21-13(3)25/h5-9,16H,4,10-11H2,1-3H3,(H2,19,20,21,22,23,25) |
| InChIKey | VWEQDSQKQSBEHT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|