C16H28O5 — CID 21351495
3-(2,5-diethyloxolan-3-yl)-3-(oxan-2-yloxy)propanoic acid (PubChem CID 21351495) has the molecular formula C16H28O5 and a molecular weight of 300.40 g/mol. Its IUPAC name is 3-(2,5-diethyloxolan-3-yl)-3-(oxan-2-yloxy)propanoic acid.
| Compound Name | 3-(2,5-diethyloxolan-3-yl)-3-(oxan-2-yloxy)propanoic acid |
|---|---|
| PubChem CID | 21351495 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 3-(2,5-diethyloxolan-3-yl)-3-(oxan-2-yloxy)propanoic acid |
| SMILES | CCC1CC(C(CC(=O)O)OC2CCCCO2)C(CC)O1 |
| InChI | InChI=1S/C16H28O5/c1-3-11-9-12(13(4-2)20-11)14(10-15(17)18)21-16-7-5-6-8-19-16/h11-14,16H,3-10H2,1-2H3,(H,17,18) |
| InChIKey | XGFKJCIKHVIQGM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |