3-(2,5-diethyloxolan-3-yl)-3-(oxan-2-yloxy)propanoic acid

C16H28O5 — CID 21351495

IUPAC3-(2,5-diethyloxolan-3-yl)-3-(oxan-2-yloxy)propanoic acid
SMILESCCC1CC(C(CC(=O)O)OC2CCCCO2)C(CC)O1
InChIInChI=1S/C16H28O5/c1-3-11-9-12(13(4-2)20-11)14(10-15(17)18)21-16-7-5-6-8-19-16/h11-14,16H,3-10H2,1-2H3,(H,17,18)
InChIKeyXGFKJCIKHVIQGM-UHFFFAOYSA-N
MW300.40 g/mol
LogP2.97
Rot. Bonds7

About 3-(2,5-diethyloxolan-3-yl)-3-(oxan-2-yloxy)propanoic acid

3-(2,5-diethyloxolan-3-yl)-3-(oxan-2-yloxy)propanoic acid (PubChem CID 21351495) has the molecular formula C16H28O5 and a molecular weight of 300.40 g/mol. Its IUPAC name is 3-(2,5-diethyloxolan-3-yl)-3-(oxan-2-yloxy)propanoic acid.

Molecular Properties

Compound Name3-(2,5-diethyloxolan-3-yl)-3-(oxan-2-yloxy)propanoic acid
PubChem CID21351495
Molecular FormulaC16H28O5
Molecular Weight300.40 g/mol
Exact Mass300.19
IUPAC Name3-(2,5-diethyloxolan-3-yl)-3-(oxan-2-yloxy)propanoic acid
SMILESCCC1CC(C(CC(=O)O)OC2CCCCO2)C(CC)O1
InChIInChI=1S/C16H28O5/c1-3-11-9-12(13(4-2)20-11)14(10-15(17)18)21-16-7-5-6-8-19-16/h11-14,16H,3-10H2,1-2H3,(H,17,18)
InChIKeyXGFKJCIKHVIQGM-UHFFFAOYSA-N
XLogP2.97
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500300.40
LogP ≤ 52.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(2,5-diethyloxolan-3-yl)-3-(oxan-2-yloxy)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,5-diethyloxolan-3-yl)-3-(oxan-2-yloxy)propanoic acid?
The IUPAC name of 3-(2,5-diethyloxolan-3-yl)-3-(oxan-2-yloxy)propanoic acid (CID 21351495) is 3-(2,5-diethyloxolan-3-yl)-3-(oxan-2-yloxy)propanoic acid.
What is the SMILES notation for 3-(2,5-diethyloxolan-3-yl)-3-(oxan-2-yloxy)propanoic acid?
The canonical SMILES for 3-(2,5-diethyloxolan-3-yl)-3-(oxan-2-yloxy)propanoic acid is CCC1CC(C(CC(=O)O)OC2CCCCO2)C(CC)O1.
What is the InChIKey of 3-(2,5-diethyloxolan-3-yl)-3-(oxan-2-yloxy)propanoic acid?
The InChIKey is XGFKJCIKHVIQGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O5/c1-3-11-9-12(13(4-2)20-11)14(10-15(17)18)21-16-7-5-6-8-19-16/h11-14,16H,3-10H2,1-2H3,(H,17,18).
What are the key properties of 3-(2,5-diethyloxolan-3-yl)-3-(oxan-2-yloxy)propanoic acid?
3-(2,5-diethyloxolan-3-yl)-3-(oxan-2-yloxy)propanoic acid has a molecular weight of 300.40 g/mol, XLogP of 2.97, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-diethyloxolan-3-yl)-3-(oxan-2-yloxy)propanoic acid is sourced from PubChem (CID 21351495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).