C27H30F3N3O — CID 21352468
N-[4-(trifluoromethoxy)phenyl]-N-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperidin-4-amine (PubChem CID 21352468) has the molecular formula C27H30F3N3O and a molecular weight of 469.55 g/mol. Its IUPAC name is N-[4-(trifluoromethoxy)phenyl]-N-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperidin-4-amine.
| Compound Name | N-[4-(trifluoromethoxy)phenyl]-N-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 21352468 |
| Molecular Formula | C27H30F3N3O |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | N-[4-(trifluoromethoxy)phenyl]-N-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperidin-4-amine |
| SMILES | Cc1cc(-c2cc(CN(c3ccc(OC(F)(F)F)cc3)C3CCNCC3)ccn2)cc(C)c1C |
| InChI | InChI=1S/C27H30F3N3O/c1-18-14-22(15-19(2)20(18)3)26-16-21(8-13-32-26)17-33(24-9-11-31-12-10-24)23-4-6-25(7-5-23)34-27(28,29)30/h4-8,13-16,24,31H,9-12,17H2,1-3H3 |
| InChIKey | TXBJDEZVEQESLX-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|