C22H27N3O5 — CID 21352745
2-piperidin-4-yloxyethyl N-[2-[(4-methoxybenzoyl)amino]phenyl]carbamate (PubChem CID 21352745) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is 2-piperidin-4-yloxyethyl N-[2-[(4-methoxybenzoyl)amino]phenyl]carbamate.
| Compound Name | 2-piperidin-4-yloxyethyl N-[2-[(4-methoxybenzoyl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 21352745 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 2-piperidin-4-yloxyethyl N-[2-[(4-methoxybenzoyl)amino]phenyl]carbamate |
| SMILES | COc1ccc(C(=O)Nc2ccccc2NC(=O)OCCOC2CCNCC2)cc1 |
| InChI | InChI=1S/C22H27N3O5/c1-28-17-8-6-16(7-9-17)21(26)24-19-4-2-3-5-20(19)25-22(27)30-15-14-29-18-10-12-23-13-11-18/h2-9,18,23H,10-15H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | IMBCJGVUEPJMQQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|