C16H26N2O7S — CID 21355179
1-[3-[2-[acetyl(hydroxy)amino]-3-ethoxy-3-oxopropyl]sulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 21355179) has the molecular formula C16H26N2O7S and a molecular weight of 390.46 g/mol. Its IUPAC name is 1-[3-[2-[acetyl(hydroxy)amino]-3-ethoxy-3-oxopropyl]sulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[3-[2-[acetyl(hydroxy)amino]-3-ethoxy-3-oxopropyl]sulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 21355179 |
| Molecular Formula | C16H26N2O7S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 1-[3-[2-[acetyl(hydroxy)amino]-3-ethoxy-3-oxopropyl]sulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCOC(=O)C(CSCC(C)C(=O)N1CCCC1C(=O)O)N(O)C(C)=O |
| InChI | InChI=1S/C16H26N2O7S/c1-4-25-16(23)13(18(24)11(3)19)9-26-8-10(2)14(20)17-7-5-6-12(17)15(21)22/h10,12-13,24H,4-9H2,1-3H3,(H,21,22) |
| InChIKey | XIVXHEVBWOUQRL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|