C17H25N3O3 — CID 21357658
3-(3-amino-2-oxo-3-phenylpyrrolidin-1-yl)-N-hydroxy-2,2,3-trimethylbutanamide (PubChem CID 21357658) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is 3-(3-amino-2-oxo-3-phenylpyrrolidin-1-yl)-N-hydroxy-2,2,3-trimethylbutanamide.
| Compound Name | 3-(3-amino-2-oxo-3-phenylpyrrolidin-1-yl)-N-hydroxy-2,2,3-trimethylbutanamide |
|---|---|
| PubChem CID | 21357658 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 3-(3-amino-2-oxo-3-phenylpyrrolidin-1-yl)-N-hydroxy-2,2,3-trimethylbutanamide |
| SMILES | CC(C)(C(=O)NO)C(C)(C)N1CCC(N)(c2ccccc2)C1=O |
| InChI | InChI=1S/C17H25N3O3/c1-15(2,13(21)19-23)16(3,4)20-11-10-17(18,14(20)22)12-8-6-5-7-9-12/h5-9,23H,10-11,18H2,1-4H3,(H,19,21) |
| InChIKey | UHYCPJKCIFEDLW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|