C25H24N6O5S2 — CID 21357878
4-[[4-amino-5-[4-[3-[(3-methoxybenzoyl)amino]phenyl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]carbamoylamino]butanoic acid (PubChem CID 21357878) has the molecular formula C25H24N6O5S2 and a molecular weight of 552.64 g/mol. Its IUPAC name is 4-[[4-amino-5-[4-[3-[(3-methoxybenzoyl)amino]phenyl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[4-amino-5-[4-[3-[(3-methoxybenzoyl)amino]phenyl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 21357878 |
| Molecular Formula | C25H24N6O5S2 |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | 4-[[4-amino-5-[4-[3-[(3-methoxybenzoyl)amino]phenyl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]carbamoylamino]butanoic acid |
| SMILES | COc1cccc(C(=O)Nc2cccc(-c3csc(-c4sc(NC(=O)NCCCC(=O)O)nc4N)n3)c2)c1 |
| InChI | InChI=1S/C25H24N6O5S2/c1-36-17-8-3-6-15(12-17)22(34)28-16-7-2-5-14(11-16)18-13-37-23(29-18)20-21(26)30-25(38-20)31-24(35)27-10-4-9-19(32)33/h2-3,5-8,11-13H,4,9-10,26H2,1H3,(H,28,34)(H,32,33)(H2,27,30,31,35) |
| InChIKey | XSFNCSUXSALWHP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 168.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|