C19H15N5OS2 — CID 22993961
N-[3-[2-(2,4-diamino-1,3-thiazol-5-yl)-1,3-thiazol-4-yl]phenyl]benzamide (PubChem CID 22993961) has the molecular formula C19H15N5OS2 and a molecular weight of 393.50 g/mol. Its IUPAC name is N-[3-[2-(2,4-diamino-1,3-thiazol-5-yl)-1,3-thiazol-4-yl]phenyl]benzamide.
| Compound Name | N-[3-[2-(2,4-diamino-1,3-thiazol-5-yl)-1,3-thiazol-4-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 22993961 |
| Molecular Formula | C19H15N5OS2 |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | N-[3-[2-(2,4-diamino-1,3-thiazol-5-yl)-1,3-thiazol-4-yl]phenyl]benzamide |
| SMILES | Nc1nc(N)c(-c2nc(-c3cccc(NC(=O)c4ccccc4)c3)cs2)s1 |
| InChI | InChI=1S/C19H15N5OS2/c20-16-15(27-19(21)24-16)18-23-14(10-26-18)12-7-4-8-13(9-12)22-17(25)11-5-2-1-3-6-11/h1-10H,20H2,(H2,21,24)(H,22,25) |
| InChIKey | FZFIYOAPPGZOJL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |