C20H22N6O3S2 — CID 21358377
N-[3-[2-[4-amino-2-(methylcarbamoylamino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-4-methyl-2-oxopentanamide (PubChem CID 21358377) has the molecular formula C20H22N6O3S2 and a molecular weight of 458.57 g/mol. Its IUPAC name is N-[3-[2-[4-amino-2-(methylcarbamoylamino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-4-methyl-2-oxopentanamide.
| Compound Name | N-[3-[2-[4-amino-2-(methylcarbamoylamino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-4-methyl-2-oxopentanamide |
|---|---|
| PubChem CID | 21358377 |
| Molecular Formula | C20H22N6O3S2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | N-[3-[2-[4-amino-2-(methylcarbamoylamino)-1,3-thiazol-5-yl]-1,3-thiazol-4-yl]phenyl]-4-methyl-2-oxopentanamide |
| SMILES | CNC(=O)Nc1nc(N)c(-c2nc(-c3cccc(NC(=O)C(=O)CC(C)C)c3)cs2)s1 |
| InChI | InChI=1S/C20H22N6O3S2/c1-10(2)7-14(27)17(28)23-12-6-4-5-11(8-12)13-9-30-18(24-13)15-16(21)25-20(31-15)26-19(29)22-3/h4-6,8-10H,7,21H2,1-3H3,(H,23,28)(H2,22,25,26,29) |
| InChIKey | VOLLOPNHWMODEZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 139.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|