C14H21N5O — CID 21360641
N,2-dimethyl-9-(3,4,5-trimethyloxolan-2-yl)purin-6-amine (PubChem CID 21360641) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is N,2-dimethyl-9-(3,4,5-trimethyloxolan-2-yl)purin-6-amine.
| Compound Name | N,2-dimethyl-9-(3,4,5-trimethyloxolan-2-yl)purin-6-amine |
|---|---|
| PubChem CID | 21360641 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | N,2-dimethyl-9-(3,4,5-trimethyloxolan-2-yl)purin-6-amine |
| SMILES | CNc1nc(C)nc2c1ncn2C1OC(C)C(C)C1C |
| InChI | InChI=1S/C14H21N5O/c1-7-8(2)14(20-9(7)3)19-6-16-11-12(15-5)17-10(4)18-13(11)19/h6-9,14H,1-5H3,(H,15,17,18) |
| InChIKey | JGPZKGYIZUJDSM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |