About methyl 4-(dihydroxymethyl)-1,3-thiazolidine-3-carboxylate
methyl 4-(dihydroxymethyl)-1,3-thiazolidine-3-carboxylate (PubChem CID 21363461) has the molecular formula C6H11NO4S
and a molecular weight of 193.22 g/mol. Its IUPAC name is methyl 4-(dihydroxymethyl)-1,3-thiazolidine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(dihydroxymethyl)-1,3-thiazolidine-3-carboxylate |
| PubChem CID | 21363461 |
| Molecular Formula | C6H11NO4S |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | methyl 4-(dihydroxymethyl)-1,3-thiazolidine-3-carboxylate |
| SMILES | COC(=O)N1CSCC1C(O)O |
| InChI | InChI=1S/C6H11NO4S/c1-11-6(10)7-3-12-2-4(7)5(8)9/h4-5,8-9H,2-3H2,1H3 |
| InChIKey | XWRBMKIYWRIFNF-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(dihydroxymethyl)-1,3-thiazolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(dihydroxymethyl)-1,3-thiazolidine-3-carboxylate?
The IUPAC name of methyl 4-(dihydroxymethyl)-1,3-thiazolidine-3-carboxylate (CID 21363461) is methyl 4-(dihydroxymethyl)-1,3-thiazolidine-3-carboxylate.
What is the SMILES notation for methyl 4-(dihydroxymethyl)-1,3-thiazolidine-3-carboxylate?
The canonical SMILES for methyl 4-(dihydroxymethyl)-1,3-thiazolidine-3-carboxylate is COC(=O)N1CSCC1C(O)O.
What is the InChIKey of methyl 4-(dihydroxymethyl)-1,3-thiazolidine-3-carboxylate?
The InChIKey is XWRBMKIYWRIFNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO4S/c1-11-6(10)7-3-12-2-4(7)5(8)9/h4-5,8-9H,2-3H2,1H3.
What are the key properties of methyl 4-(dihydroxymethyl)-1,3-thiazolidine-3-carboxylate?
methyl 4-(dihydroxymethyl)-1,3-thiazolidine-3-carboxylate has a molecular weight of 193.22 g/mol, XLogP of -0.56, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(dihydroxymethyl)-1,3-thiazolidine-3-carboxylate is sourced from PubChem (CID 21363461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).