About carbanide;methyl 4-(dihydroxymethyl)-1,3-thiazolidin-2-ide-3-carboxylate;yttrium
carbanide;methyl 4-(dihydroxymethyl)-1,3-thiazolidin-2-ide-3-carboxylate;yttrium (PubChem CID 59870089) has the molecular formula C7H13NO4SY-2
and a molecular weight of 296.16 g/mol. Its IUPAC name is carbanide;methyl 4-(dihydroxymethyl)-1,3-thiazolidin-2-ide-3-carboxylate;yttrium.
Molecular Properties
| Compound Name | carbanide;methyl 4-(dihydroxymethyl)-1,3-thiazolidin-2-ide-3-carboxylate;yttrium |
| PubChem CID | 59870089 |
| Molecular Formula | C7H13NO4SY-2 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.96 |
| IUPAC Name | carbanide;methyl 4-(dihydroxymethyl)-1,3-thiazolidin-2-ide-3-carboxylate;yttrium |
| SMILES | COC(=O)N1[CH-]SCC1C(O)O.[CH3-].[Y] |
| InChI | InChI=1S/C6H10NO4S.CH3.Y/c1-11-6(10)7-3-12-2-4(7)5(8)9;;/h3-5,8-9H,2H2,1H3;1H3;/q2*-1; |
| InChIKey | DKNFBIFGVXQABO-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze carbanide;methyl 4-(dihydroxymethyl)-1,3-thiazolidin-2-ide-3-carboxylate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;methyl 4-(dihydroxymethyl)-1,3-thiazolidin-2-ide-3-carboxylate;yttrium?
The IUPAC name of carbanide;methyl 4-(dihydroxymethyl)-1,3-thiazolidin-2-ide-3-carboxylate;yttrium (CID 59870089) is carbanide;methyl 4-(dihydroxymethyl)-1,3-thiazolidin-2-ide-3-carboxylate;yttrium.
What is the SMILES notation for carbanide;methyl 4-(dihydroxymethyl)-1,3-thiazolidin-2-ide-3-carboxylate;yttrium?
The canonical SMILES for carbanide;methyl 4-(dihydroxymethyl)-1,3-thiazolidin-2-ide-3-carboxylate;yttrium is COC(=O)N1[CH-]SCC1C(O)O.[CH3-].[Y].
What is the InChIKey of carbanide;methyl 4-(dihydroxymethyl)-1,3-thiazolidin-2-ide-3-carboxylate;yttrium?
The InChIKey is DKNFBIFGVXQABO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10NO4S.CH3.Y/c1-11-6(10)7-3-12-2-4(7)5(8)9;;/h3-5,8-9H,2H2,1H3;1H3;/q2*-1;.
What are the key properties of carbanide;methyl 4-(dihydroxymethyl)-1,3-thiazolidin-2-ide-3-carboxylate;yttrium?
carbanide;methyl 4-(dihydroxymethyl)-1,3-thiazolidin-2-ide-3-carboxylate;yttrium has a molecular weight of 296.16 g/mol, XLogP of 0.05, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;methyl 4-(dihydroxymethyl)-1,3-thiazolidin-2-ide-3-carboxylate;yttrium is sourced from PubChem (CID 59870089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).