C12H24O2 — CID 21363584
(2,2-diethyl-3,3-dimethylbutyl) acetate (PubChem CID 21363584) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is (2,2-diethyl-3,3-dimethylbutyl) acetate.
| Compound Name | (2,2-diethyl-3,3-dimethylbutyl) acetate |
|---|---|
| PubChem CID | 21363584 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | (2,2-diethyl-3,3-dimethylbutyl) acetate |
| SMILES | CCC(CC)(COC(C)=O)C(C)(C)C |
| InChI | InChI=1S/C12H24O2/c1-7-12(8-2,11(4,5)6)9-14-10(3)13/h7-9H2,1-6H3 |
| InChIKey | DDUJVXAOGFQYTK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |