C10H24OSi — CID 123841304
(2,2-diethyl-3,3-dimethylbutoxy)silane (PubChem CID 123841304) has the molecular formula C10H24OSi and a molecular weight of 188.39 g/mol. Its IUPAC name is (2,2-diethyl-3,3-dimethylbutoxy)silane.
| Compound Name | (2,2-diethyl-3,3-dimethylbutoxy)silane |
|---|---|
| PubChem CID | 123841304 |
| Molecular Formula | C10H24OSi |
| Molecular Weight | 188.39 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | (2,2-diethyl-3,3-dimethylbutoxy)silane |
| SMILES | CCC(CC)(CO[SiH3])C(C)(C)C |
| InChI | InChI=1S/C10H24OSi/c1-6-10(7-2,8-11-12)9(3,4)5/h6-8H2,1-5,12H3 |
| InChIKey | BPDOXTUHCAKXBJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|