About dibromo-(3,3-diethyl-2-methylpentan-2-yl)alumane
dibromo-(3,3-diethyl-2-methylpentan-2-yl)alumane (PubChem CID 139836923) has the molecular formula C10H21AlBr2
and a molecular weight of 328.07 g/mol. Its IUPAC name is dibromo-(3,3-diethyl-2-methylpentan-2-yl)alumane.
Molecular Properties
| Compound Name | dibromo-(3,3-diethyl-2-methylpentan-2-yl)alumane |
| PubChem CID | 139836923 |
| Molecular Formula | C10H21AlBr2 |
| Molecular Weight | 328.07 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | dibromo-(3,3-diethyl-2-methylpentan-2-yl)alumane |
| SMILES | CCC(CC)(CC)C(C)(C)[Al](Br)Br |
| InChI | InChI=1S/C10H21.Al.2BrH/c1-6-10(7-2,8-3)9(4)5;;;/h6-8H2,1-5H3;;2*1H/q;+2;;/p-2 |
| InChIKey | UYRKCOYHGZLJJY-UHFFFAOYSA-L |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.07 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dibromo-(3,3-diethyl-2-methylpentan-2-yl)alumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibromo-(3,3-diethyl-2-methylpentan-2-yl)alumane?
The IUPAC name of dibromo-(3,3-diethyl-2-methylpentan-2-yl)alumane (CID 139836923) is dibromo-(3,3-diethyl-2-methylpentan-2-yl)alumane.
What is the SMILES notation for dibromo-(3,3-diethyl-2-methylpentan-2-yl)alumane?
The canonical SMILES for dibromo-(3,3-diethyl-2-methylpentan-2-yl)alumane is CCC(CC)(CC)C(C)(C)[Al](Br)Br.
What is the InChIKey of dibromo-(3,3-diethyl-2-methylpentan-2-yl)alumane?
The InChIKey is UYRKCOYHGZLJJY-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H21.Al.2BrH/c1-6-10(7-2,8-3)9(4)5;;;/h6-8H2,1-5H3;;2*1H/q;+2;;/p-2.
What are the key properties of dibromo-(3,3-diethyl-2-methylpentan-2-yl)alumane?
dibromo-(3,3-diethyl-2-methylpentan-2-yl)alumane has a molecular weight of 328.07 g/mol, XLogP of 5.26, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibromo-(3,3-diethyl-2-methylpentan-2-yl)alumane is sourced from PubChem (CID 139836923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).