C8H20OSi — CID 173401924
[(3R)-2,2,3-trimethylpentan-3-yl]oxysilane (PubChem CID 173401924) has the molecular formula C8H20OSi and a molecular weight of 160.33 g/mol. Its IUPAC name is [(3R)-2,2,3-trimethylpentan-3-yl]oxysilane.
| Compound Name | [(3R)-2,2,3-trimethylpentan-3-yl]oxysilane |
|---|---|
| PubChem CID | 173401924 |
| Molecular Formula | C8H20OSi |
| Molecular Weight | 160.33 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | [(3R)-2,2,3-trimethylpentan-3-yl]oxysilane |
| SMILES | CC[C@@](C)(O[SiH3])C(C)(C)C |
| InChI | InChI=1S/C8H20OSi/c1-6-8(5,9-10)7(2,3)4/h6H2,1-5,10H3/t8-/m1/s1 |
| InChIKey | XSKVEZWMZCLCNL-MRVPVSSYSA-N |
| XLogP | 1.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|