C14H31BrMgOSi — CID 154479762
magnesium;2,2,3-trimethylundecan-3-yloxysilane;bromide (PubChem CID 154479762) has the molecular formula C14H31BrMgOSi and a molecular weight of 347.70 g/mol. Its IUPAC name is magnesium;2,2,3-trimethylundecan-3-yloxysilane;bromide.
| Compound Name | magnesium;2,2,3-trimethylundecan-3-yloxysilane;bromide |
|---|---|
| PubChem CID | 154479762 |
| Molecular Formula | C14H31BrMgOSi |
| Molecular Weight | 347.70 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | magnesium;2,2,3-trimethylundecan-3-yloxysilane;bromide |
| SMILES | C[CH-]CCCCCCC(C)(O[SiH3])C(C)(C)C.[Br-].[Mg+2] |
| InChI | InChI=1S/C14H31OSi.BrH.Mg/c1-6-7-8-9-10-11-12-14(5,15-16)13(2,3)4;;/h6H,7-12H2,1-5,16H3;1H;/q-1;;+2/p-1 |
| InChIKey | VYOHHGUINGRAAS-UHFFFAOYSA-M |
| XLogP | 0.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.70 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|