C13H30OSi — CID 173402101
2,2,3-trimethyldecan-3-yloxysilane (PubChem CID 173402101) has the molecular formula C13H30OSi and a molecular weight of 230.47 g/mol. Its IUPAC name is 2,2,3-trimethyldecan-3-yloxysilane.
| Compound Name | 2,2,3-trimethyldecan-3-yloxysilane |
|---|---|
| PubChem CID | 173402101 |
| Molecular Formula | C13H30OSi |
| Molecular Weight | 230.47 g/mol |
| Exact Mass | 230.21 |
| IUPAC Name | 2,2,3-trimethyldecan-3-yloxysilane |
| SMILES | CCCCCCCC(C)(O[SiH3])C(C)(C)C |
| InChI | InChI=1S/C13H30OSi/c1-6-7-8-9-10-11-13(5,14-15)12(2,3)4/h6-11H2,1-5,15H3 |
| InChIKey | QCBTVBWCQMZOIZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|