C23H24N2O5 — CID 21364113
3-[(7-butoxy-4-oxoquinolizine-3-carbonyl)amino]-3-phenylpropanoic acid (PubChem CID 21364113) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is 3-[(7-butoxy-4-oxoquinolizine-3-carbonyl)amino]-3-phenylpropanoic acid.
| Compound Name | 3-[(7-butoxy-4-oxoquinolizine-3-carbonyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 21364113 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 3-[(7-butoxy-4-oxoquinolizine-3-carbonyl)amino]-3-phenylpropanoic acid |
| SMILES | CCCCOc1ccc2ccc(C(=O)NC(CC(=O)O)c3ccccc3)c(=O)n2c1 |
| InChI | InChI=1S/C23H24N2O5/c1-2-3-13-30-18-11-9-17-10-12-19(23(29)25(17)15-18)22(28)24-20(14-21(26)27)16-7-5-4-6-8-16/h4-12,15,20H,2-3,13-14H2,1H3,(H,24,28)(H,26,27) |
| InChIKey | GISZAEGJVIBBIB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|