C6H16N2O — CID 21364272
N-methoxy-N',N'-dimethylpropane-1,3-diamine (PubChem CID 21364272) has the molecular formula C6H16N2O and a molecular weight of 132.21 g/mol. Its IUPAC name is N-methoxy-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-methoxy-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 21364272 |
| Molecular Formula | C6H16N2O |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.13 |
| IUPAC Name | N-methoxy-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CONCCCN(C)C |
| InChI | InChI=1S/C6H16N2O/c1-8(2)6-4-5-7-9-3/h7H,4-6H2,1-3H3 |
| InChIKey | WMYXBMYMMWAWBK-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|