C16H12N4O6S — CID 2136464
[3,5-dimethyl-4-(2-nitrophenyl)sulfanylpyrazol-1-yl]-(5-nitrofuran-2-yl)methanone (PubChem CID 2136464) has the molecular formula C16H12N4O6S and a molecular weight of 388.36 g/mol. Its IUPAC name is [3,5-dimethyl-4-(2-nitrophenyl)sulfanylpyrazol-1-yl]-(5-nitrofuran-2-yl)methanone.
| Compound Name | [3,5-dimethyl-4-(2-nitrophenyl)sulfanylpyrazol-1-yl]-(5-nitrofuran-2-yl)methanone |
|---|---|
| PubChem CID | 2136464 |
| Molecular Formula | C16H12N4O6S |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | [3,5-dimethyl-4-(2-nitrophenyl)sulfanylpyrazol-1-yl]-(5-nitrofuran-2-yl)methanone |
| SMILES | Cc1nn(C(=O)c2ccc([N+](=O)[O-])o2)c(C)c1Sc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12N4O6S/c1-9-15(27-13-6-4-3-5-11(13)19(22)23)10(2)18(17-9)16(21)12-7-8-14(26-12)20(24)25/h3-8H,1-2H3 |
| InChIKey | PVOCXANQARSTAR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 134.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|