C18H20 — CID 21365328
1,4-dimethyl-1,4-bis(penta-1,3-diynyl)cyclohexane (PubChem CID 21365328) has the molecular formula C18H20 and a molecular weight of 236.36 g/mol. Its IUPAC name is 1,4-dimethyl-1,4-bis(penta-1,3-diynyl)cyclohexane.
| Compound Name | 1,4-dimethyl-1,4-bis(penta-1,3-diynyl)cyclohexane |
|---|---|
| PubChem CID | 21365328 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 1,4-dimethyl-1,4-bis(penta-1,3-diynyl)cyclohexane |
| SMILES | CC#CC#CC1(C)CCC(C)(C#CC#CC)CC1 |
| InChI | InChI=1S/C18H20/c1-5-7-9-11-17(3)13-15-18(4,16-14-17)12-10-8-6-2/h13-16H2,1-4H3 |
| InChIKey | VMCLSGNBIZSKQP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|