C28H38O2 — CID 134884558
1-[8-(1-hydroxy-2,2,6,6-tetramethylcyclohexyl)octa-1,3,5,7-tetraynyl]-2,2,6,6-tetramethylcyclohexan-1-ol (PubChem CID 134884558) has the molecular formula C28H38O2 and a molecular weight of 406.61 g/mol. Its IUPAC name is 1-[8-(1-hydroxy-2,2,6,6-tetramethylcyclohexyl)octa-1,3,5,7-tetraynyl]-2,2,6,6-tetramethylcyclohexan-1-ol.
| Compound Name | 1-[8-(1-hydroxy-2,2,6,6-tetramethylcyclohexyl)octa-1,3,5,7-tetraynyl]-2,2,6,6-tetramethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 134884558 |
| Molecular Formula | C28H38O2 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | 1-[8-(1-hydroxy-2,2,6,6-tetramethylcyclohexyl)octa-1,3,5,7-tetraynyl]-2,2,6,6-tetramethylcyclohexan-1-ol |
| SMILES | CC1(C)CCCC(C)(C)C1(O)C#CC#CC#CC#CC1(O)C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C28H38O2/c1-23(2)17-15-18-24(3,4)27(23,29)21-13-11-9-10-12-14-22-28(30)25(5,6)19-16-20-26(28,7)8/h29-30H,15-20H2,1-8H3 |
| InChIKey | KOUPOEXGILKHNY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|