C11H25N4O+ — CID 21365728
[3-[2-aminoethynyl(methylaminomethyl)amino]-2-hydroxypropyl]-ethyl-dimethylazanium (PubChem CID 21365728) has the molecular formula C11H25N4O+ and a molecular weight of 229.35 g/mol. Its IUPAC name is [3-[2-aminoethynyl(methylaminomethyl)amino]-2-hydroxypropyl]-ethyl-dimethylazanium.
| Compound Name | [3-[2-aminoethynyl(methylaminomethyl)amino]-2-hydroxypropyl]-ethyl-dimethylazanium |
|---|---|
| PubChem CID | 21365728 |
| Molecular Formula | C11H25N4O+ |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | [3-[2-aminoethynyl(methylaminomethyl)amino]-2-hydroxypropyl]-ethyl-dimethylazanium |
| SMILES | CC[N+](C)(C)CC(O)CN(C#CN)CNC |
| InChI | InChI=1S/C11H25N4O/c1-5-15(3,4)9-11(16)8-14(7-6-12)10-13-2/h11,13,16H,5,8-10,12H2,1-4H3/q+1 |
| InChIKey | QZWVGZWOTJIULW-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|