C16H21N6O2P — CID 21366041
1-[6-[4-(dimethylphosphorylmethyl)imidazol-1-yl]-1H-benzimidazol-2-yl]-3-ethylurea (PubChem CID 21366041) has the molecular formula C16H21N6O2P and a molecular weight of 360.36 g/mol. Its IUPAC name is 1-[6-[4-(dimethylphosphorylmethyl)imidazol-1-yl]-1H-benzimidazol-2-yl]-3-ethylurea.
| Compound Name | 1-[6-[4-(dimethylphosphorylmethyl)imidazol-1-yl]-1H-benzimidazol-2-yl]-3-ethylurea |
|---|---|
| PubChem CID | 21366041 |
| Molecular Formula | C16H21N6O2P |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 1-[6-[4-(dimethylphosphorylmethyl)imidazol-1-yl]-1H-benzimidazol-2-yl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1nc2ccc(-n3cnc(CP(C)(C)=O)c3)cc2[nH]1 |
| InChI | InChI=1S/C16H21N6O2P/c1-4-17-16(23)21-15-19-13-6-5-12(7-14(13)20-15)22-8-11(18-10-22)9-25(2,3)24/h5-8,10H,4,9H2,1-3H3,(H3,17,19,20,21,23) |
| InChIKey | FAALTMWELCHXNL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|