C23H31NO2S — CID 21367134
2-(4-tert-butylphenoxy)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]propanamide (PubChem CID 21367134) has the molecular formula C23H31NO2S and a molecular weight of 385.57 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]propanamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]propanamide |
|---|---|
| PubChem CID | 21367134 |
| Molecular Formula | C23H31NO2S |
| Molecular Weight | 385.57 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]propanamide |
| SMILES | Cc1ccc(CSCCNC(=O)C(C)Oc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H31NO2S/c1-17-6-8-19(9-7-17)16-27-15-14-24-22(25)18(2)26-21-12-10-20(11-13-21)23(3,4)5/h6-13,18H,14-16H2,1-5H3,(H,24,25) |
| InChIKey | GJMNIPWUMIWQKP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|