C17H25NO4S — CID 119241322
2-[2-[2-(4-tert-butylphenoxy)propanoylamino]ethylsulfanyl]acetic acid (PubChem CID 119241322) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is 2-[2-[2-(4-tert-butylphenoxy)propanoylamino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[2-(4-tert-butylphenoxy)propanoylamino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119241322 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-[2-[2-(4-tert-butylphenoxy)propanoylamino]ethylsulfanyl]acetic acid |
| SMILES | CC(Oc1ccc(C(C)(C)C)cc1)C(=O)NCCSCC(=O)O |
| InChI | InChI=1S/C17H25NO4S/c1-12(16(21)18-9-10-23-11-15(19)20)22-14-7-5-13(6-8-14)17(2,3)4/h5-8,12H,9-11H2,1-4H3,(H,18,21)(H,19,20) |
| InChIKey | GKSBNOHWDZYSPS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|