C21H34N2O2 — CID 99702455
(2R)-2-(4-tert-butylphenoxy)-N-[2-(1-methylpiperidin-4-yl)ethyl]propanamide (PubChem CID 99702455) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is (2R)-2-(4-tert-butylphenoxy)-N-[2-(1-methylpiperidin-4-yl)ethyl]propanamide.
| Compound Name | (2R)-2-(4-tert-butylphenoxy)-N-[2-(1-methylpiperidin-4-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 99702455 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | (2R)-2-(4-tert-butylphenoxy)-N-[2-(1-methylpiperidin-4-yl)ethyl]propanamide |
| SMILES | C[C@@H](Oc1ccc(C(C)(C)C)cc1)C(=O)NCCC1CCN(C)CC1 |
| InChI | InChI=1S/C21H34N2O2/c1-16(25-19-8-6-18(7-9-19)21(2,3)4)20(24)22-13-10-17-11-14-23(5)15-12-17/h6-9,16-17H,10-15H2,1-5H3,(H,22,24)/t16-/m1/s1 |
| InChIKey | MBLFXKZTMMGUGQ-MRXNPFEDSA-N |
| XLogP | 3.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |