C25H27FN2O4S — CID 21367163
2-(4-tert-butylphenoxy)-N-[4-[(4-fluorophenyl)sulfamoyl]phenyl]propanamide (PubChem CID 21367163) has the molecular formula C25H27FN2O4S and a molecular weight of 470.57 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-[4-[(4-fluorophenyl)sulfamoyl]phenyl]propanamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-[4-[(4-fluorophenyl)sulfamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 21367163 |
| Molecular Formula | C25H27FN2O4S |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-[4-[(4-fluorophenyl)sulfamoyl]phenyl]propanamide |
| SMILES | CC(Oc1ccc(C(C)(C)C)cc1)C(=O)Nc1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H27FN2O4S/c1-17(32-22-13-5-18(6-14-22)25(2,3)4)24(29)27-20-11-15-23(16-12-20)33(30,31)28-21-9-7-19(26)8-10-21/h5-17,28H,1-4H3,(H,27,29) |
| InChIKey | CLTDVJUVUDGSBP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |