C26H27F3N2O4S — CID 21367346
2-(4-tert-butylphenoxy)-N-[4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]propanamide (PubChem CID 21367346) has the molecular formula C26H27F3N2O4S and a molecular weight of 520.57 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-[4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]propanamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-[4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 21367346 |
| Molecular Formula | C26H27F3N2O4S |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-[4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]propanamide |
| SMILES | CC(Oc1ccc(C(C)(C)C)cc1)C(=O)Nc1ccc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C26H27F3N2O4S/c1-17(35-22-12-8-18(9-13-22)25(2,3)4)24(32)30-20-10-14-23(15-11-20)36(33,34)31-21-7-5-6-19(16-21)26(27,28)29/h5-17,31H,1-4H3,(H,30,32) |
| InChIKey | JNFPLTOWXZBSCT-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |