C28H22N2O5 — CID 21370567
methyl 2-[4-[(E)-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)iminomethyl]phenoxy]acetate (PubChem CID 21370567) has the molecular formula C28H22N2O5 and a molecular weight of 466.49 g/mol. Its IUPAC name is methyl 2-[4-[(E)-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)iminomethyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[(E)-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)iminomethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 21370567 |
| Molecular Formula | C28H22N2O5 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | methyl 2-[4-[(E)-(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)iminomethyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(/C=N/N2C(=O)C3C4c5ccccc5C(c5ccccc54)C3C2=O)cc1 |
| InChI | InChI=1S/C28H22N2O5/c1-34-22(31)15-35-17-12-10-16(11-13-17)14-29-30-27(32)25-23-18-6-2-3-7-19(18)24(26(25)28(30)33)21-9-5-4-8-20(21)23/h2-14,23-26H,15H2,1H3/b29-14+ |
| InChIKey | VLDNRPLPSCBFIN-IPPBACCNSA-N |
| XLogP | 3.46 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|