C32H23BrN2O3 — CID 124558774
(15R,19S)-17-[(Z)-[4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 124558774) has the molecular formula C32H23BrN2O3 and a molecular weight of 563.45 g/mol. Its IUPAC name is (15R,19S)-17-[(Z)-[4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,19S)-17-[(Z)-[4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 124558774 |
| Molecular Formula | C32H23BrN2O3 |
| Molecular Weight | 563.45 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | (15R,19S)-17-[(Z)-[4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1[C@@H]2C3c4ccccc4C(c4ccccc43)[C@@H]2C(=O)N1/N=C\c1ccc(OCc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C32H23BrN2O3/c33-21-13-9-20(10-14-21)18-38-22-15-11-19(12-16-22)17-34-35-31(36)29-27-23-5-1-2-6-24(23)28(30(29)32(35)37)26-8-4-3-7-25(26)27/h1-17,27-30H,18H2/b34-17-/t27?,28?,29-,30+ |
| InChIKey | PASPJSPDTAZGJP-YFSFSFRRSA-N |
| XLogP | 6.25 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.45 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|