C26H19BrN4O3S — CID 21371040
2-[4-[5-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]phenyl]isoindole-1,3-dione (PubChem CID 21371040) has the molecular formula C26H19BrN4O3S and a molecular weight of 547.43 g/mol. Its IUPAC name is 2-[4-[5-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[5-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 21371040 |
| Molecular Formula | C26H19BrN4O3S |
| Molecular Weight | 547.43 g/mol |
| Exact Mass | 546.04 |
| IUPAC Name | 2-[4-[5-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-4-ethyl-1,2,4-triazol-3-yl]phenyl]isoindole-1,3-dione |
| SMILES | CCn1c(SCC(=O)c2ccc(Br)cc2)nnc1-c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C26H19BrN4O3S/c1-2-30-23(28-29-26(30)35-15-22(32)16-7-11-18(27)12-8-16)17-9-13-19(14-10-17)31-24(33)20-5-3-4-6-21(20)25(31)34/h3-14H,2,15H2,1H3 |
| InChIKey | RYJDGRLLHOEHEO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.43 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|