C26H27N5O3S — CID 21371043
N-cyclohexyl-2-[[5-[4-(1,3-dioxoisoindol-2-yl)phenyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 21371043) has the molecular formula C26H27N5O3S and a molecular weight of 489.60 g/mol. Its IUPAC name is N-cyclohexyl-2-[[5-[4-(1,3-dioxoisoindol-2-yl)phenyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-cyclohexyl-2-[[5-[4-(1,3-dioxoisoindol-2-yl)phenyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 21371043 |
| Molecular Formula | C26H27N5O3S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | N-cyclohexyl-2-[[5-[4-(1,3-dioxoisoindol-2-yl)phenyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCn1c(SCC(=O)NC2CCCCC2)nnc1-c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C26H27N5O3S/c1-2-30-23(28-29-26(30)35-16-22(32)27-18-8-4-3-5-9-18)17-12-14-19(15-13-17)31-24(33)20-10-6-7-11-21(20)25(31)34/h6-7,10-15,18H,2-5,8-9,16H2,1H3,(H,27,32) |
| InChIKey | CCNGGSWMPBCQFG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|