C20H14Cl4N2O3S — CID 21372113
2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(2,3-dichlorophenyl)acetamide (PubChem CID 21372113) has the molecular formula C20H14Cl4N2O3S and a molecular weight of 504.22 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(2,3-dichlorophenyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(2,3-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 21372113 |
| Molecular Formula | C20H14Cl4N2O3S |
| Molecular Weight | 504.22 g/mol |
| Exact Mass | 501.95 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(2,3-dichlorophenyl)acetamide |
| SMILES | O=C(CN(c1cc(Cl)cc(Cl)c1)S(=O)(=O)c1ccccc1)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C20H14Cl4N2O3S/c21-13-9-14(22)11-15(10-13)26(30(28,29)16-5-2-1-3-6-16)12-19(27)25-18-8-4-7-17(23)20(18)24/h1-11H,12H2,(H,25,27) |
| InChIKey | XDYPBWVGLJBZPH-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.22 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |