C26H20Cl2N2O3S — CID 126129468
2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(2-phenylphenyl)acetamide (PubChem CID 126129468) has the molecular formula C26H20Cl2N2O3S and a molecular weight of 511.43 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(2-phenylphenyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(2-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 126129468 |
| Molecular Formula | C26H20Cl2N2O3S |
| Molecular Weight | 511.43 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3,5-dichloroanilino]-N-(2-phenylphenyl)acetamide |
| SMILES | O=C(CN(c1cc(Cl)cc(Cl)c1)S(=O)(=O)c1ccccc1)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C26H20Cl2N2O3S/c27-20-15-21(28)17-22(16-20)30(34(32,33)23-11-5-2-6-12-23)18-26(31)29-25-14-8-7-13-24(25)19-9-3-1-4-10-19/h1-17H,18H2,(H,29,31) |
| InChIKey | FLPXTBVUJNJGPF-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.43 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |