C27H21N3O3S — CID 47013285
2-[N-(benzenesulfonyl)-3-cyanoanilino]-N-(2-phenylphenyl)acetamide (PubChem CID 47013285) has the molecular formula C27H21N3O3S and a molecular weight of 467.55 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-cyanoanilino]-N-(2-phenylphenyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-cyanoanilino]-N-(2-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 47013285 |
| Molecular Formula | C27H21N3O3S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-cyanoanilino]-N-(2-phenylphenyl)acetamide |
| SMILES | N#Cc1cccc(N(CC(=O)Nc2ccccc2-c2ccccc2)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C27H21N3O3S/c28-19-21-10-9-13-23(18-21)30(34(32,33)24-14-5-2-6-15-24)20-27(31)29-26-17-8-7-16-25(26)22-11-3-1-4-12-22/h1-18H,20H2,(H,29,31) |
| InChIKey | YBXWFCXSOORWKT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |