C26H21N3O — CID 21374478
(Z)-2-cyano-N-(2,3-dimethylphenyl)-3-(1-naphthalen-2-ylpyrrol-2-yl)prop-2-enamide (PubChem CID 21374478) has the molecular formula C26H21N3O and a molecular weight of 391.47 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,3-dimethylphenyl)-3-(1-naphthalen-2-ylpyrrol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,3-dimethylphenyl)-3-(1-naphthalen-2-ylpyrrol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 21374478 |
| Molecular Formula | C26H21N3O |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (Z)-2-cyano-N-(2,3-dimethylphenyl)-3-(1-naphthalen-2-ylpyrrol-2-yl)prop-2-enamide |
| SMILES | Cc1cccc(NC(=O)/C(C#N)=C\c2cccn2-c2ccc3ccccc3c2)c1C |
| InChI | InChI=1S/C26H21N3O/c1-18-7-5-11-25(19(18)2)28-26(30)22(17-27)16-23-10-6-14-29(23)24-13-12-20-8-3-4-9-21(20)15-24/h3-16H,1-2H3,(H,28,30)/b22-16- |
| InChIKey | AJTHCQRYYOTRRZ-JWGURIENSA-N |
| XLogP | 5.79 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|