C22H18BrN3O — CID 126023925
(Z)-3-[1-(3-bromophenyl)pyrrol-2-yl]-2-cyano-N-(2-ethylphenyl)prop-2-enamide (PubChem CID 126023925) has the molecular formula C22H18BrN3O and a molecular weight of 420.31 g/mol. Its IUPAC name is (Z)-3-[1-(3-bromophenyl)pyrrol-2-yl]-2-cyano-N-(2-ethylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[1-(3-bromophenyl)pyrrol-2-yl]-2-cyano-N-(2-ethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126023925 |
| Molecular Formula | C22H18BrN3O |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | (Z)-3-[1-(3-bromophenyl)pyrrol-2-yl]-2-cyano-N-(2-ethylphenyl)prop-2-enamide |
| SMILES | CCc1ccccc1NC(=O)/C(C#N)=C\c1cccn1-c1cccc(Br)c1 |
| InChI | InChI=1S/C22H18BrN3O/c1-2-16-7-3-4-11-21(16)25-22(27)17(15-24)13-19-10-6-12-26(19)20-9-5-8-18(23)14-20/h3-14H,2H2,1H3,(H,25,27)/b17-13- |
| InChIKey | FUYTVJWYFCHHLX-LGMDPLHJSA-N |
| XLogP | 5.35 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|