C22H19BrN4O — CID 3866477
N-(3-bromophenyl)-2-cyano-3-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]prop-2-enamide (PubChem CID 3866477) has the molecular formula C22H19BrN4O and a molecular weight of 435.33 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-cyano-3-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]prop-2-enamide.
| Compound Name | N-(3-bromophenyl)-2-cyano-3-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3866477 |
| Molecular Formula | C22H19BrN4O |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | N-(3-bromophenyl)-2-cyano-3-[1-[4-(dimethylamino)phenyl]pyrrol-2-yl]prop-2-enamide |
| SMILES | CN(C)c1ccc(-n2cccc2C=C(C#N)C(=O)Nc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C22H19BrN4O/c1-26(2)19-8-10-20(11-9-19)27-12-4-7-21(27)13-16(15-24)22(28)25-18-6-3-5-17(23)14-18/h3-14H,1-2H3,(H,25,28) |
| InChIKey | SKSQGENFXYELMU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|