C31H31N3O2S — CID 21376951
(5E)-5-[[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 21376951) has the molecular formula C31H31N3O2S and a molecular weight of 509.68 g/mol. Its IUPAC name is (5E)-5-[[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 21376951 |
| Molecular Formula | C31H31N3O2S |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | (5E)-5-[[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]-3-(naphthalen-1-ylmethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCN(CC)c1ccc(-n2c(C)cc(/C=C3/SC(=O)N(Cc4cccc5ccccc45)C3=O)c2C)cc1 |
| InChI | InChI=1S/C31H31N3O2S/c1-5-32(6-2)26-14-16-27(17-15-26)34-21(3)18-25(22(34)4)19-29-30(35)33(31(36)37-29)20-24-12-9-11-23-10-7-8-13-28(23)24/h7-19H,5-6,20H2,1-4H3/b29-19+ |
| InChIKey | WIQJWDYEHDUJPM-VUTHCHCSSA-N |
| XLogP | 7.33 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|